Systematic / IUPAC Name: N-(1-Amino-1-oxopropan-2-yl)-3-(cyclohexylcarbamoylamino)-1,4,5-trihydroxycyclohexane-1-carboxamide
ID: Reference9527
Other Names:
Cyclohexanecarboxamide, N-(2-amino-1-methyl-2-oxoethyl)-3-[[(cyclohexylamino)carbonyl]amino]-1,4,5-trihydroxy-;
NAT2-15251
Formula: C17H30N4O6
N-(1-Amino-1-oxo-2-propanyl)-3-[(cyclohexylcarbamoyl)amino]-1,4,5-trihydroxycyclohexanecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3950 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/26/2020 4:53:55 PM |
| InChI | InChI=1S/C17H30N4O6/c1-9(14(18)24)19-15(25)17(27)7-11(13(23)12(22)8-17)21-16(26)20-10-5-3-2-4-6-10/h9-13,22-23,27H,2-8H2,1H3,(H2,18,24)(H,19,25)(H2,20,21,26) |
| InChI Key | PAZLVYJYBDDTHF-UHFFFAOYSA-N |
| Canonical SMILES | CC(C(=O)N)NC(=O)C1(CC(C(C(C1)O)O)NC(=O)NC2CCCCC2)O |
| CAS | |
| Splash | |
| Other Names |
Cyclohexanecarboxamide, N-(2-amino-1-methyl-2-oxoethyl)-3-[[(cyclohexylamino)carbonyl]amino]-1,4,5-trihydroxy-; NAT2-15251 |