Systematic / IUPAC Name: N-[(1R,9S)-6-Oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]pyridine-4-carboxamide
ID: Reference9569
Other Names:
4-Pyridinecarboxamide, N-[(1R,5S)-1,3,4,5,6,8-hexahydro-8-oxo-1,5-methano-2H-pyrido[1,2-a][1,5]diazocin-9-yl]-;
NAT11-282672
Formula: C17H18N4O2
N-[(1R,9S)-6-Oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]isonicotinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3023 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/3/2020 1:18:02 PM |
| InChI | InChI=1S/C17H18N4O2/c22-16(12-3-5-18-6-4-12)20-14-1-2-15-13-7-11(8-19-9-13)10-21(15)17(14)23/h1-6,11,13,19H,7-10H2,(H,20,22)/t11-,13+/m0/s1 |
| InChI Key | GBLJVJHWHMFLBM-WCQYABFASA-N |
| Canonical SMILES | C1C2CNCC1C3=CC=C(C(=O)N3C2)NC(=O)C4=CC=NC=C4 |
| CAS | |
| Splash | |
| Other Names |
4-Pyridinecarboxamide, N-[(1R,5S)-1,3,4,5,6,8-hexahydro-8-oxo-1,5-methano-2H-pyrido[1,2-a][1,5]diazocin-9-yl]-; NAT11-282672 |