Systematic / IUPAC Name: [(3S,3aR,6R,6aS)-3-[(4-Acetylphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate
ID: Reference9596
Other Names:
D-Glucitol, 2-[[[(4-acetylphenyl)amino]carbonyl]amino]-1,4:3,6-dianhydro-2-deoxy-, 5-[[3-(trifluoromethyl)phenyl]carbamate];
NAT6-269907
Formula: C23H22F3N3O6
2-{[(4-Acetylphenyl)carbamoyl]amino}-1,4:3,6-dianhydro-2-deoxy-5-O-{[3-(trifluoromethyl)phenyl]carbamoyl}-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3377 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/15/2020 7:45:56 AM |
| InChI | InChI=1S/C23H22F3N3O6/c1-12(30)13-5-7-15(8-6-13)27-21(31)29-17-10-33-20-18(11-34-19(17)20)35-22(32)28-16-4-2-3-14(9-16)23(24,25)26/h2-9,17-20H,10-11H2,1H3,(H,28,32)(H2,27,29,31)/t17-,18+,19+,20+/m0/s1 |
| InChI Key | MZVMAAVHUZYXNX-MTQWCTHYSA-N |
| Canonical SMILES | CC(=O)C1=CC=C(C=C1)NC(=O)NC2COC3C2OCC3OC(=O)NC4=CC=CC(=C4)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
D-Glucitol, 2-[[[(4-acetylphenyl)amino]carbonyl]amino]-1,4:3,6-dianhydro-2-deoxy-, 5-[[3-(trifluoromethyl)phenyl]carbamate]; NAT6-269907 |