Systematic / IUPAC Name: N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methylnonanamide
ID: Reference964
Other Names:
8-Methyl-N-vanillylnonanamide;
Nonanamide, 8-methyl-N-vanillyl-;
8-Methyl dihydrocapsaicin;
6,7-Dihydrocapsaicin
Formula: C18H29NO3
Class: Endogenous Metabolites
Dihydrocapsaicin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 147 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/16/2015 11:19:59 AM |
| InChI | InChI=1S/C18H29NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h10-12,14,20H,4-9,13H2,1-3H3,(H,19,21) |
| InChI Key | XJQPQKLURWNAAH-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)CCCCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
| CAS | 19408845 |
| Splash | |
| Other Names |
8-Methyl-N-vanillylnonanamide; Nonanamide, 8-methyl-N-vanillyl-; 8-Methyl dihydrocapsaicin; 6,7-Dihydrocapsaicin |
| KEGG | C16952 |
| HMDb | HMDB38457 |
| ChEBI | CHEBI:46932 |
| ChEMBL | CHEMBL311158 |
| PubChem | 107982 |
| ChemSpider | 97096 |
| Wikipedia | Dihydrocapsaicin |
| ChemIDPlus | 019408845 |