Systematic / IUPAC Name: (3β,25R)-Spirost-5-en-3-ol
ID: Reference965
Other Names:
3β-Hydroxy-5-spirostene;
Nitogenin;
(20R,25R)-Spirost-5-en-3β-ol;
Spirost-5-en-3-β-ol, (25R)-;
(25R)-Spirost-5-en-3β-ol
Formula: C27H42O3
Class: Endogenous Metabolites
Diosgenin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 191 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 6/12/2025 10:36:42 AM |
| InChI | InChI=1S/C27H42O3/c1-16-7-12-27(29-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(28)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28H,6-15H2,1-4H3/t16-,17+,19+,20-,21+,22+,23+,24+,25+,26+,27-/m1/s1 |
| InChI Key | WQLVFSAGQJTQCK-VKROHFNGSA-N |
| Canonical SMILES | OC2C/C1=C/CC5C(C1(C)CC2)CCC6(C4C(OC3(OCC(CC3)C)C4C)CC56)C |
| CAS | 512049 |
| Splash | |
| Other Names |
3β-Hydroxy-5-spirostene; Nitogenin; (20R,25R)-Spirost-5-en-3β-ol; Spirost-5-en-3-β-ol, (25R)-; (25R)-Spirost-5-en-3β-ol; Spirost-5-en-3-ol, (3β,25S)- |
| ChemIDPlus | 000512061 |
| PubChem | 99474 |
| Wikipedia | Diosgenin |
| ChemSpider | 89870 |
| ChEBI | CHEBI:4629 |
| KEGG | C08898 |
| ChEMBL | CHEMBL412437 |