Systematic / IUPAC Name: 3-[2-(2-Methoxyethoxy)pyridin-3-yl]-5-[(2S)-1-[(4-nitrophenyl)methyl]pyrrolidin-2-yl]-1,2,4-oxadiazole
ID: Reference9650
Other Names:
Pyridine, 2-(2-methoxyethoxy)-3-[5-[(2S)-1-[(4-nitrophenyl)methyl]-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl]-;
NAT18-430257
Formula: C21H23N5O5
2-(2-Methoxyethoxy)-3-{5-[(2S)-1-(4-nitrobenzyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1085 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/30/2020 7:20:40 AM |
| InChI | InChI=1S/C21H23N5O5/c1-29-12-13-30-20-17(4-2-10-22-20)19-23-21(31-24-19)18-5-3-11-25(18)14-15-6-8-16(9-7-15)26(27)28/h2,4,6-10,18H,3,5,11-14H2,1H3/t18-/m0/s1 |
| InChI Key | SVMKGBJLHBGOES-SFHVURJKSA-N |
| Canonical SMILES | COCCOC1=C(C=CC=N1)C2=NOC(=N2)C3CCCN3CC4=CC=C(C=C4)[N+](=O)[O-] |
| CAS | |
| Splash | |
| Other Names |
Pyridine, 2-(2-methoxyethoxy)-3-[5-[(2S)-1-[(4-nitrophenyl)methyl]-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl]-; NAT18-430257 |