Systematic / IUPAC Name: 4-Methoxy-N-[(3S,5S)-5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1-methylpyrrolidin-3-yl]benzamide
ID: Reference9653
Other Names:
Benzamide, 4-methoxy-N-[(3S,5S)-5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1-methyl-3-pyrrolidinyl]-;
NAT18-356346
Formula: C22H24N4O4
4-Methoxy-N-{(3S,5S)-5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1-methyl-3-pyrrolidinyl}benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1165 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/30/2020 6:03:08 PM |
| InChI | InChI=1S/C22H24N4O4/c1-26-13-16(23-21(27)15-6-10-18(29-3)11-7-15)12-19(26)22-24-20(25-30-22)14-4-8-17(28-2)9-5-14/h4-11,16,19H,12-13H2,1-3H3,(H,23,27)/t16-,19-/m0/s1 |
| InChI Key | WACBZJKNYQFNMO-LPHOPBHVSA-N |
| Canonical SMILES | CN1CC(CC1C2=NC(=NO2)C3=CC=C(C=C3)OC)NC(=O)C4=CC=C(C=C4)OC |
| CAS | |
| Splash | |
| Other Names |
Benzamide, 4-methoxy-N-[(3S,5S)-5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1-methyl-3-pyrrolidinyl]-; NAT18-356346 |