Systematic / IUPAC Name: {4-[2-Hydroxy-3-(isopropylamino)propoxy]phenyl}acetic acid
ID: Reference991
Other Names:
Atenolol acid;
Metoprolol acid;
4-{2-Hydroxy-3-[(1-methylethyl)amino]propoxy}benzeneacetic acid ;
Benzeneacetic acid, 4-{2-hydroxy-3-[(1-methylethyl)amino]propoxy}-
Formula: C14H21NO4
Class: Therapeutics/Prescription Drugs
Atenolol acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 1 |
| No. of Spectra | 68 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/14/2016 9:04:07 AM |
| InChI | InChI=1S/C14H21NO4/c1-10(2)15-8-12(16)9-19-13-5-3-11(4-6-13)7-14(17)18/h3-6,10,12,15-16H,7-9H2,1-2H3,(H,17,18) |
| InChI Key | PUQIRTNPJRFRCZ-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)Cc1ccc(OCC(O)CNC(C)C)cc1 |
| CAS | 56392144 |
| Splash | |
| Other Names |
Atenolol acid; Metoprolol acid; 4-{2-Hydroxy-3-[(1-methylethyl)amino]propoxy}benzeneacetic acid ; Benzeneacetic acid, 4-{2-hydroxy-3-[(1-methylethyl)amino]propoxy}- |