Systematic / IUPAC Name: Hexadecanoic acid
ID: Reference9949
Other Names:
Cetylic acid;
Edenor C16;
Emersol 140;
Emersol 143;
Hexadecoate
; more
Formula: C16H32O2
Class: Endogenous Metabolites
Palmitic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 50 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/24/2020 11:44:24 AM |
| InChI | InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18) |
| InChI Key | IPCSVZSSVZVIGE-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCCCCCCCCCC(=O)O |
| CAS | 57103 |
| Splash | |
| Other Names |
Cetylic acid; Edenor C16; Emersol 140; Emersol 143; Hexadecoate; Hexadecoic acid; Hexaectylic acid; Hydrofol; Loxiol EP 278; Lunac P 95; Lunac P 95KC; Lunac P 98; n-Hexadecoate; n-Hexadecoic acid; Palmitate; Palmitinate; Palmitinic acid; Palmitinsaeure; Palmitoate; Palmitoic acid; 1-Hexyldecanoate; 1-Hexyldecanoic acid; 1-Pentadecanecarboxylic acid; Hexadecanoic acid palmitic acid; Hexadecylic acid; n-Hexadecanoic acid; Pentadecanecarboxylate; Pentadecanecarboxylic acid |
| PubChem | 985 |
| KEGG | C00249 |
| ChemIDPlus | 000057103 |
| ChEMBL | CHEMBL82293 |
| HMDb | HMDB0000220 |
| DrugBank | DB03796 |
| ChemSpider | 960 |
| Wikipedia | Palmitic_Acid |
| WebBook | 13653965 |
| ChEBI | CHEBI:15756 |