Systematic / IUPAC Name: 1-[(1R,9S)-11-Benzoyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]-3-(2-methoxyphenyl)urea
ID: Reference9991
Other Names:
Urea, N-[(1R,5S)-3-benzoyl-1,3,4,5,6,8-hexahydro-8-oxo-1,5-methano-2H-pyrido[1,2-a][1,5]diazocin-9-yl]-N'-(2-methoxyphenyl)-;
NAT11-281526
Formula: C26H26N4O4
1-[(1R,9S)-11-Benzoyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]-3-(2-methoxyphenyl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4247 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/21/2020 12:09:32 PM |
| InChI | InChI=1S/C26H26N4O4/c1-34-23-10-6-5-9-20(23)27-26(33)28-21-11-12-22-19-13-17(15-30(22)25(21)32)14-29(16-19)24(31)18-7-3-2-4-8-18/h2-12,17,19H,13-16H2,1H3,(H2,27,28,33)/t17-,19+/m0/s1 |
| InChI Key | VEFBVXRBIWGTHM-PKOBYXMFSA-N |
| Canonical SMILES | COC1=CC=CC=C1NC(=O)NC2=CC=C3C4CC(CN(C4)C(=O)C5=CC=CC=C5)CN3C2=O |
| CAS | |
| Splash | |
| Other Names |
Urea, N-[(1R,5S)-3-benzoyl-1,3,4,5,6,8-hexahydro-8-oxo-1,5-methano-2H-pyrido[1,2-a][1,5]diazocin-9-yl]-N'-(2-methoxyphenyl)-; NAT11-281526 |