Systematic / IUPAC Name: 1-[4-[4-[5-[(2S)-1-(2-Methylpropyl)pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]pyridin-2-yl]piperazin-1-yl]ethanone
ID: Reference10044
Other Names:
Ethanone, 1-[4-[4-[5-[(2S)-1-(2-methylpropyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]-1-piperazinyl]-;
NAT18-428427
Formula: C21H30N6O2
1-[4-(4-{5-[(2S)-1-Isobutyl-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-pyridinyl)-1-piperazinyl]ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 300 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/6/2020 2:07:16 PM |
| InChI | InChI=1S/C21H30N6O2/c1-15(2)14-27-8-4-5-18(27)21-23-20(24-29-21)17-6-7-22-19(13-17)26-11-9-25(10-12-26)16(3)28/h6-7,13,15,18H,4-5,8-12,14H2,1-3H3/t18-/m0/s1 |
| InChI Key | ZZDIFAHVVQROPE-SFHVURJKSA-N |
| Canonical SMILES | CC(C)CN1CCCC1C2=NC(=NO2)C3=CC(=NC=C3)N4CCN(CC4)C(=O)C |
| CAS | |
| Splash | |
| Other Names |
Ethanone, 1-[4-[4-[5-[(2S)-1-(2-methylpropyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]-1-piperazinyl]-; NAT18-428427 |