Systematic / IUPAC Name: Cyclopropyl-[(3S)-3-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methanone
ID: Reference10058
Other Names:
Methanone, cyclopropyl[(3S)-3-(5-phenyl-1,3,4-oxadiazol-2-yl)-1-pyrrolidinyl]-;
NAT31-462820
Formula: C16H17N3O2
Cyclopropyl[(3S)-3-(5-phenyl-1,3,4-oxadiazol-2-yl)-1-pyrrolidinyl]methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 935 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/12/2020 8:33:09 AM |
| InChI | InChI=1S/C16H17N3O2/c20-16(12-6-7-12)19-9-8-13(10-19)15-18-17-14(21-15)11-4-2-1-3-5-11/h1-5,12-13H,6-10H2/t13-/m0/s1 |
| InChI Key | JGTFEIJZAZPMPD-ZDUSSCGKSA-N |
| Canonical SMILES | C1CC1C(=O)N2CCC(C2)C3=NN=C(O3)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names |
Methanone, cyclopropyl[(3S)-3-(5-phenyl-1,3,4-oxadiazol-2-yl)-1-pyrrolidinyl]-; NAT31-462820 |