Systematic / IUPAC Name: 2-[(3S)-1-Cyclohexylpyrrolidin-3-yl]-5-(1H-indol-3-ylmethyl)-1,3,4-oxadiazole
ID: Reference10064
Other Names:
1H-Indole, 3-[[5-[(3S)-1-cyclohexyl-3-pyrrolidinyl]-1,3,4-oxadiazol-2-yl]methyl]-;
NAT31-459341
Formula: C21H26N4O
3-({5-[(3S)-1-Cyclohexyl-3-pyrrolidinyl]-1,3,4-oxadiazol-2-yl}methyl)-1H-indole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 494 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/12/2020 8:38:09 AM |
| InChI | InChI=1S/C21H26N4O/c1-2-6-17(7-3-1)25-11-10-15(14-25)21-24-23-20(26-21)12-16-13-22-19-9-5-4-8-18(16)19/h4-5,8-9,13,15,17,22H,1-3,6-7,10-12,14H2/t15-/m0/s1 |
| InChI Key | SBUJKRFLVTYJKO-HNNXBMFYSA-N |
| Canonical SMILES | C1CCC(CC1)N2CCC(C2)C3=NN=C(O3)CC4=CNC5=CC=CC=C54 |
| CAS | |
| Splash | |
| Other Names |
1H-Indole, 3-[[5-[(3S)-1-cyclohexyl-3-pyrrolidinyl]-1,3,4-oxadiazol-2-yl]methyl]-; NAT31-459341 |
| PubChem | 51137362 |
| ChEMBL | CHEMBL3436807 |
| ChemSpider | 29850368 |