Systematic / IUPAC Name: N-[[(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]oxolan-2-yl]methyl]-4-(dimethylamino)benzamide
ID: Reference10095
Other Names: NAT19-353728
Formula: C24H31N3O6
N-{[(2R,3S,4R,5S)-3,4-Dihydroxy-5-{2-[(4-methoxybenzyl)amino]-2-oxoethyl}tetrahydro-2-furanyl]methyl}-4-(dimethylamino)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4828 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/27/2020 12:08:15 PM |
| InChI | InChI=1S/C24H31N3O6/c1-27(2)17-8-6-16(7-9-17)24(31)26-14-20-23(30)22(29)19(33-20)12-21(28)25-13-15-4-10-18(32-3)11-5-15/h4-11,19-20,22-23,29-30H,12-14H2,1-3H3,(H,25,28)(H,26,31)/t19-,20+,22-,23+/m0/s1 |
| InChI Key | MWHJJRDYGAUQAJ-PABCKOPISA-N |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)C(=O)NCC2C(C(C(O2)CC(=O)NCC3=CC=C(C=C3)OC)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-353728 |