Systematic / IUPAC Name: Phenyl-[(3S)-3-(5-propyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methanone
ID: Reference10126
Other Names:
Methanone, phenyl[(3S)-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1-pyrrolidinyl]-;
NAT31-465782
Formula: C16H19N3O2
Phenyl[(3S)-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1-pyrrolidinyl]methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 265 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/3/2020 2:07:13 PM |
| InChI | InChI=1S/C16H19N3O2/c1-2-6-14-17-18-15(21-14)13-9-10-19(11-13)16(20)12-7-4-3-5-8-12/h3-5,7-8,13H,2,6,9-11H2,1H3/t13-/m0/s1 |
| InChI Key | NJNBFTWWQZLDMN-ZDUSSCGKSA-N |
| Canonical SMILES | CCCC1=NN=C(O1)C2CCN(C2)C(=O)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names |
Methanone, phenyl[(3S)-3-(5-propyl-1,3,4-oxadiazol-2-yl)-1-pyrrolidinyl]-; NAT31-465782 |