Systematic / IUPAC Name: 2-[(3S)-1-[(2-Chlorophenyl)methyl]pyrrolidin-3-yl]-5-[(4-fluorophenoxy)methyl]-1,3,4-oxadiazole
ID: Reference10134
Other Names:
1,3,4-Oxadiazole, 2-[(3S)-1-[(2-chlorophenyl)methyl]-3-pyrrolidinyl]-5-[(4-fluorophenoxy)methyl]-;
NAT31-461045
Formula: C20H19ClFN3O2
2-[(3S)-1-(2-Chlorobenzyl)-3-pyrrolidinyl]-5-[(4-fluorophenoxy)methyl]-1,3,4-oxadiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1805 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/4/2020 12:35:31 PM |
| InChI | InChI=1S/C20H19ClFN3O2/c21-18-4-2-1-3-14(18)11-25-10-9-15(12-25)20-24-23-19(27-20)13-26-17-7-5-16(22)6-8-17/h1-8,15H,9-13H2/t15-/m0/s1 |
| InChI Key | XVGSNDMQMMQHCR-HNNXBMFYSA-N |
| Canonical SMILES | C1CN(CC1C2=NN=C(O2)COC3=CC=C(C=C3)F)CC4=CC=CC=C4Cl |
| CAS | |
| Splash | |
| Other Names |
1,3,4-Oxadiazole, 2-[(3S)-1-[(2-chlorophenyl)methyl]-3-pyrrolidinyl]-5-[(4-fluorophenoxy)methyl]-; NAT31-461045 |