Systematic / IUPAC Name: 1-[(1R,2S,3R,5R)-5-Cyclohexyl-2,3-dihydroxycyclopentyl]-3-ethylurea
ID: Reference10146
Other Names:
Urea, N-[(1R,2S,3R,5R)-5-cyclohexyl-2,3-dihydroxycyclopentyl]-N'-ethyl-;
NAT38-536231
Formula: C14H26N2O3
1-[(1R,2S,3R,5R)-5-Cyclohexyl-2,3-dihydroxycyclopentyl]-3-ethylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3523 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/11/2020 11:19:23 AM |
| InChI | InChI=1S/C14H26N2O3/c1-2-15-14(19)16-12-10(8-11(17)13(12)18)9-6-4-3-5-7-9/h9-13,17-18H,2-8H2,1H3,(H2,15,16,19)/t10-,11-,12-,13-/m1/s1 |
| InChI Key | GLGDYCZNHXCMLE-FDYHWXHSSA-N |
| Canonical SMILES | CCNC(=O)NC1C(CC(C1O)O)C2CCCCC2 |
| CAS | |
| Splash | |
| Other Names |
Urea, N-[(1R,2S,3R,5R)-5-cyclohexyl-2,3-dihydroxycyclopentyl]-N'-ethyl-; NAT38-536231 |