Systematic / IUPAC Name: 2-(2-Fluorophenyl)-5-[(3S)-1-[[3-(trifluoromethoxy)phenyl]methyl]pyrrolidin-3-yl]-1,3,4-oxadiazole
ID: Reference10179
Other Names:
1,3,4-Oxadiazole, 2-(2-fluorophenyl)-5-[(3S)-1-[[3-(trifluoromethoxy)phenyl]methyl]-3-pyrrolidinyl]-;
NAT31-461798
Formula: C20H17F4N3O2
2-(2-Fluorophenyl)-5-{(3S)-1-[3-(trifluoromethoxy)benzyl]-3-pyrrolidinyl}-1,3,4-oxadiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 797 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/14/2021 12:30:52 PM |
| InChI | InChI=1S/C20H17F4N3O2/c21-17-7-2-1-6-16(17)19-26-25-18(28-19)14-8-9-27(12-14)11-13-4-3-5-15(10-13)29-20(22,23)24/h1-7,10,14H,8-9,11-12H2/t14-/m0/s1 |
| InChI Key | JRYQSXKTGFTVAM-AWEZNQCLSA-N |
| Canonical SMILES | C1CN(CC1C2=NN=C(O2)C3=CC=CC=C3F)CC4=CC(=CC=C4)OC(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
1,3,4-Oxadiazole, 2-(2-fluorophenyl)-5-[(3S)-1-[[3-(trifluoromethoxy)phenyl]methyl]-3-pyrrolidinyl]-; NAT31-461798 |