Systematic / IUPAC Name: N-[4-[(2R,3R)-3-(Hydroxymethyl)-4-methyl-5-oxomorpholin-2-yl]phenyl]acetamide
ID: Reference10196
Other Names:
Acetamide, N-[4-[(2R,3R)-3-(hydroxymethyl)-4-methyl-5-oxo-2-morpholinyl]phenyl]-;
NAT36-531629
Formula: C14H18N2O4
N-{4-[(2R,3R)-3-(Hydroxymethyl)-4-methyl-5-oxo-2-morpholinyl]phenyl}acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2474 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/21/2021 1:10:35 PM |
| InChI | InChI=1S/C14H18N2O4/c1-9(18)15-11-5-3-10(4-6-11)14-12(7-17)16(2)13(19)8-20-14/h3-6,12,14,17H,7-8H2,1-2H3,(H,15,18)/t12-,14-/m1/s1 |
| InChI Key | FNXLRMBMPFMFJE-TZMCWYRMSA-N |
| Canonical SMILES | CC(=O)NC1=CC=C(C=C1)C2C(N(C(=O)CO2)C)CO |
| CAS | |
| Splash | |
| Other Names |
Acetamide, N-[4-[(2R,3R)-3-(hydroxymethyl)-4-methyl-5-oxo-2-morpholinyl]phenyl]-; NAT36-531629 |