Systematic / IUPAC Name: 1-[4-[(2R,3R)-3-(Hydroxymethyl)-4-methyl-5-oxomorpholin-2-yl]phenyl]-3-propan-2-ylurea
ID: Reference10203
Other Names:
Urea, N-[4-[(2R,3R)-3-(hydroxymethyl)-4-methyl-5-oxo-2-morpholinyl]phenyl]-N'-(1-methylethyl)-;
NAT36-531657
Formula: C16H23N3O4
1-{4-[(2R,3R)-3-(Hydroxymethyl)-4-methyl-5-oxo-2-morpholinyl]phenyl}-3-isopropylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2744 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/28/2021 2:24:17 PM |
| InChI | InChI=1S/C16H23N3O4/c1-10(2)17-16(22)18-12-6-4-11(5-7-12)15-13(8-20)19(3)14(21)9-23-15/h4-7,10,13,15,20H,8-9H2,1-3H3,(H2,17,18,22)/t13-,15-/m1/s1 |
| InChI Key | WFDHUDKZLYLOQS-UKRRQHHQSA-N |
| Canonical SMILES | CC(C)NC(=O)NC1=CC=C(C=C1)C2C(N(C(=O)CO2)C)CO |
| CAS | |
| Splash | |
| Other Names |
Urea, N-[4-[(2R,3R)-3-(hydroxymethyl)-4-methyl-5-oxo-2-morpholinyl]phenyl]-N'-(1-methylethyl)-; NAT36-531657 |