Systematic / IUPAC Name: N-[4-[(2R,3R)-3-(Hydroxymethyl)-5-oxo-4-(pyridin-3-ylmethyl)morpholin-2-yl]phenyl]-5-methyl-1,2-oxazole-3-carboxamide
ID: Reference10207
Other Names:
3-Isoxazolecarboxamide, N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxo-4-(3-pyridinylmethyl)-2-morpholinyl]phenyl]-5-methyl-;
NAT36-531229
Formula: C22H22N4O5
N-{4-[(2R,3R)-3-(Hydroxymethyl)-5-oxo-4-(3-pyridinylmethyl)-2-morpholinyl]phenyl}-5-methyl-1,2-oxazole-3-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1496 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/28/2021 2:33:44 PM |
| InChI | InChI=1S/C22H22N4O5/c1-14-9-18(25-31-14)22(29)24-17-6-4-16(5-7-17)21-19(12-27)26(20(28)13-30-21)11-15-3-2-8-23-10-15/h2-10,19,21,27H,11-13H2,1H3,(H,24,29)/t19-,21-/m1/s1 |
| InChI Key | QETCYBMCUXNFJF-TZIWHRDSSA-N |
| Canonical SMILES | CC1=CC(=NO1)C(=O)NC2=CC=C(C=C2)C3C(N(C(=O)CO3)CC4=CN=CC=C4)CO |
| CAS | |
| Splash | |
| Other Names |
3-Isoxazolecarboxamide, N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxo-4-(3-pyridinylmethyl)-2-morpholinyl]phenyl]-5-methyl-; NAT36-531229 |