Systematic / IUPAC Name: 2-[(2R,3R)-3-(Hydroxymethyl)-2-[4-[(2-methoxyacetyl)amino]phenyl]-5-oxomorpholin-4-yl]-N,N-dimethylacetamide
ID: Reference10220
Other Names:
4-Morpholineacetamide, 3-(hydroxymethyl)-2-[4-[(2-methoxyacetyl)amino]phenyl]-N,N-dimethyl-5-oxo-, (2R,3R)-;
NAT36-531385
Formula: C18H25N3O6
2-[(2R,3R)-3-(Hydroxymethyl)-2-{4-[(methoxyacetyl)amino]phenyl}-5-oxo-4-morpholinyl]-N,N-dimethylacetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1399 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/5/2021 1:24:28 PM |
| InChI | InChI=1S/C18H25N3O6/c1-20(2)16(24)8-21-14(9-22)18(27-11-17(21)25)12-4-6-13(7-5-12)19-15(23)10-26-3/h4-7,14,18,22H,8-11H2,1-3H3,(H,19,23)/t14-,18-/m1/s1 |
| InChI Key | KCJAANWABONSIQ-RDTXWAMCSA-N |
| Canonical SMILES | CN(C)C(=O)CN1C(C(OCC1=O)C2=CC=C(C=C2)NC(=O)COC)CO |
| CAS | |
| Splash | |
| Other Names |
4-Morpholineacetamide, 3-(hydroxymethyl)-2-[4-[(2-methoxyacetyl)amino]phenyl]-N,N-dimethyl-5-oxo-, (2R,3R)-; NAT36-531385 |