Systematic / IUPAC Name: N-[4-[(2R,3R)-3-(Hydroxymethyl)-5-oxo-4-propan-2-ylmorpholin-2-yl]phenyl]-5-methyl-1,2-oxazole-3-carboxamide
ID: Reference10222
Other Names:
3-Isoxazolecarboxamide, N-[4-[(2R,3R)-3-(hydroxymethyl)-4-(1-methylethyl)-5-oxo-2-morpholinyl]phenyl]-5-methyl-;
NAT36-531091
Formula: C19H23N3O5
N-{4-[(2R,3R)-3-(Hydroxymethyl)-4-isopropyl-5-oxo-2-morpholinyl]phenyl}-5-methyl-1,2-oxazole-3-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 694 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/5/2021 1:28:24 PM |
| InChI | InChI=1S/C19H23N3O5/c1-11(2)22-16(9-23)18(26-10-17(22)24)13-4-6-14(7-5-13)20-19(25)15-8-12(3)27-21-15/h4-8,11,16,18,23H,9-10H2,1-3H3,(H,20,25)/t16-,18-/m1/s1 |
| InChI Key | CQBKSLRCCKHBDZ-SJLPKXTDSA-N |
| Canonical SMILES | CC1=CC(=NO1)C(=O)NC2=CC=C(C=C2)C3C(N(C(=O)CO3)C(C)C)CO |
| CAS | |
| Splash | |
| Other Names |
3-Isoxazolecarboxamide, N-[4-[(2R,3R)-3-(hydroxymethyl)-4-(1-methylethyl)-5-oxo-2-morpholinyl]phenyl]-5-methyl-; NAT36-531091 |