Systematic / IUPAC Name: 2-Ethyl-N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]butanamide
ID: Reference10244
Other Names:
Butanamide, 2-ethyl-N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxo-2-morpholinyl]phenyl]-;
NAT36-530809
Formula: C17H24N2O4
2-Ethyl-N-{4-[(2R,3R)-3-(hydroxymethyl)-5-oxo-2-morpholinyl]phenyl}butanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2891 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/18/2021 2:47:28 PM |
| InChI | InChI=1S/C17H24N2O4/c1-3-11(4-2)17(22)18-13-7-5-12(6-8-13)16-14(9-20)19-15(21)10-23-16/h5-8,11,14,16,20H,3-4,9-10H2,1-2H3,(H,18,22)(H,19,21)/t14-,16-/m1/s1 |
| InChI Key | BEGUNXPPCSLCJP-GDBMZVCRSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
Butanamide, 2-ethyl-N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxo-2-morpholinyl]phenyl]-; NAT36-530809 |