Systematic / IUPAC Name: (1R,2S,3R,4R)-3-(Cyclopentylmethylamino)-4-phenylcyclopentane-1,2-diol
ID: Reference10252
Other Names: NAT38-536864
Formula: C17H25NO2
(1R,2S,3R,4R)-3-[(Cyclopentylmethyl)amino]-4-phenyl-1,2-cyclopentanediol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1827 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/26/2021 12:46:37 PM |
| InChI | InChI=1S/C17H25NO2/c19-15-10-14(13-8-2-1-3-9-13)16(17(15)20)18-11-12-6-4-5-7-12/h1-3,8-9,12,14-20H,4-7,10-11H2/t14-,15-,16-,17-/m1/s1 |
| InChI Key | PZHQFMGKOJLEBE-QBPKDAKJSA-N |
| Canonical SMILES | C1CCC(C1)CNC2C(CC(C2O)O)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT38-536864 |