Systematic / IUPAC Name: 1-[4-[(2R,3R)-3-(Hydroxymethyl)-4-(2-methylpropyl)-5-oxomorpholin-2-yl]phenyl]-3-propan-2-ylurea
ID: Reference10267
Other Names:
Urea, N-[4-[(2R,3R)-3-(hydroxymethyl)-4-(2-methylpropyl)-5-oxo-2-morpholinyl]phenyl]-N'-(1-methylethyl)-;
NAT36-531036
Formula: C19H29N3O4
1-{4-[(2R,3R)-3-(Hydroxymethyl)-4-isobutyl-5-oxo-2-morpholinyl]phenyl}-3-isopropylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3954 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/5/2021 1:09:16 PM |
| InChI | InChI=1S/C19H29N3O4/c1-12(2)9-22-16(10-23)18(26-11-17(22)24)14-5-7-15(8-6-14)21-19(25)20-13(3)4/h5-8,12-13,16,18,23H,9-11H2,1-4H3,(H2,20,21,25)/t16-,18-/m1/s1 |
| InChI Key | OESOXWRMFFJZII-SJLPKXTDSA-N |
| Canonical SMILES | CC(C)CN1C(C(OCC1=O)C2=CC=C(C=C2)NC(=O)NC(C)C)CO |
| CAS | |
| Splash | |
| Other Names |
Urea, N-[4-[(2R,3R)-3-(hydroxymethyl)-4-(2-methylpropyl)-5-oxo-2-morpholinyl]phenyl]-N'-(1-methylethyl)-; NAT36-531036 |