Systematic / IUPAC Name: N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-pyridin-3-ylcyclopentyl]cyclopropanecarboxamide
ID: Reference10285
Other Names:
Cyclopropanecarboxamide, N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-(3-pyridinyl)cyclopentyl]-;
NAT38-536195
Formula: C14H18N2O3
N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-(3-pyridinyl)cyclopentyl]cyclopropanecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3028 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/12/2021 7:58:01 AM |
| InChI | InChI=1S/C14H18N2O3/c17-11-6-10(9-2-1-5-15-7-9)12(13(11)18)16-14(19)8-3-4-8/h1-2,5,7-8,10-13,17-18H,3-4,6H2,(H,16,19)/t10-,11-,12-,13-/m1/s1 |
| InChI Key | YSNURBIPEQTNOA-FDYHWXHSSA-N |
| Canonical SMILES | C1CC1C(=O)NC2C(CC(C2O)O)C3=CN=CC=C3 |
| CAS | |
| Splash | |
| Other Names |
Cyclopropanecarboxamide, N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-(3-pyridinyl)cyclopentyl]-; NAT38-536195 |