Systematic / IUPAC Name: N-[4-[(2R,3R)-3-(Hydroxymethyl)-4-(2-methylpropyl)-5-oxomorpholin-2-yl]phenyl]-3-methylbutanamide
ID: Reference10286
Other Names:
Butanamide, N-[4-[(2R,3R)-3-(hydroxymethyl)-4-(2-methylpropyl)-5-oxo-2-morpholinyl]phenyl]-3-methyl-;
NAT36-531037
Formula: C20H30N2O4
N-{4-[(2R,3R)-3-(Hydroxymethyl)-4-isobutyl-5-oxo-2-morpholinyl]phenyl}-3-methylbutanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1179 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/12/2021 9:26:49 AM |
| InChI | InChI=1S/C20H30N2O4/c1-13(2)9-18(24)21-16-7-5-15(6-8-16)20-17(11-23)22(10-14(3)4)19(25)12-26-20/h5-8,13-14,17,20,23H,9-12H2,1-4H3,(H,21,24)/t17-,20-/m1/s1 |
| InChI Key | WHXWBESJJFAHSE-YLJYHZDGSA-N |
| Canonical SMILES | CC(C)CC(=O)NC1=CC=C(C=C1)C2C(N(C(=O)CO2)CC(C)C)CO |
| CAS | |
| Splash | |
| Other Names |
Butanamide, N-[4-[(2R,3R)-3-(hydroxymethyl)-4-(2-methylpropyl)-5-oxo-2-morpholinyl]phenyl]-3-methyl-; NAT36-531037 |