Systematic / IUPAC Name: N-(2-Butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-1-benzofuran-5-yl)methanesulfonamide
ID: Reference1029
Other Names:
Multaq;
N-[2-Butyl-3-({4-[3-(dibutylamino)propoxy]phenyl}-oxomethyl)-5-benzofuranyl]methanesulfonamide ;
N-(2-Butyl-3-{4-[3-(dibutylamino)propoxy]phenyl}carbonyl-1-benzofuran-5-yl)methanesulfonamide ;
Methanesulfonamide, N-(2-butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-5-benzofuranyl)-
Formula: C31H44N2O5S
Class: Therapeutics/Prescription Drugs
Dronedarone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 1 |
| No. of Spectra | 53 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/14/2016 11:49:33 AM |
| InChI | InChI=1S/C31H44N2O5S/c1-5-8-12-29-30(27-23-25(32-39(4,35)36)15-18-28(27)38-29)31(34)24-13-16-26(17-14-24)37-22-11-21-33(19-9-6-2)20-10-7-3/h13-18,23,32H,5-12,19-22H2,1-4H3 |
| InChI Key | ZQTNQVWKHCQYLQ-UHFFFAOYSA-N |
| Canonical SMILES | CCCCC1=C(C2=C(O1)C=CC(=C2)NS(=O)(=O)C)C(=O)C3=CC=C(C=C3)OCCCN(CCCC)CCCC |
| CAS | 141626360 |
| Splash | |
| Other Names |
Multaq; N-[2-Butyl-3-({4-[3-(dibutylamino)propoxy]phenyl}-oxomethyl)-5-benzofuranyl]methanesulfonamide ; N-(2-Butyl-3-{4-[3-(dibutylamino)propoxy]phenyl}carbonyl-1-benzofuran-5-yl)methanesulfonamide ; Methanesulfonamide, N-(2-butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-5-benzofuranyl)- |
| ChemSpider | 180996 |
| KEGG | D02537 |
| ChemIDPlus | 141626360 |
| PubChem | 208898 |
| ChEMBL | CHEMBL184412 |
| Wikipedia | Dronedarone |
| ChEBI | CHEBI:50659 |