Systematic / IUPAC Name: 2-[(3S)-1-[(2-Fluorophenyl)methyl]pyrrolidin-3-yl]-6-(trifluoromethyl)-1H-benzimidazole
ID: Reference10294
Other Names: NAT31-457560
Formula: C19H17F4N3
2-[(3S)-1-(2-Fluorobenzyl)-3-pyrrolidinyl]-5-(trifluoromethyl)-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 240 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/12/2021 12:42:45 PM |
| InChI | InChI=1S/C19H17F4N3/c20-15-4-2-1-3-12(15)10-26-8-7-13(11-26)18-24-16-6-5-14(19(21,22)23)9-17(16)25-18/h1-6,9,13H,7-8,10-11H2,(H,24,25)/t13-/m0/s1 |
| InChI Key | MNBXCMMNVPCGFT-ZDUSSCGKSA-N |
| Canonical SMILES | C1CN(CC1C2=NC3=C(N2)C=C(C=C3)C(F)(F)F)CC4=CC=CC=C4F |
| CAS | |
| Splash | |
| Other Names | NAT31-457560 |