Systematic / IUPAC Name: 2-[(3S)-1-[(2-Methylphenyl)methyl]pyrrolidin-3-yl]-1H-imidazo[4,5-b]pyridine
ID: Reference10295
Other Names: NAT31-456640
Formula: C18H20N4
2-[(3S)-1-(2-Methylbenzyl)-3-pyrrolidinyl]-1H-imidazo[4,5-b]pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 699 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/12/2021 12:54:07 PM |
| InChI | InChI=1S/C18H20N4/c1-13-5-2-3-6-14(13)11-22-10-8-15(12-22)17-20-16-7-4-9-19-18(16)21-17/h2-7,9,15H,8,10-12H2,1H3,(H,19,20,21)/t15-/m0/s1 |
| InChI Key | XYSAELPEUXGHAR-HNNXBMFYSA-N |
| Canonical SMILES | CC1=CC=CC=C1CN2CCC(C2)C3=NC4=C(N3)C=CC=N4 |
| CAS | |
| Splash | |
| Other Names | NAT31-456640 |