Systematic / IUPAC Name: N-[[(1S,4S,6S)-4-[2-[Benzyl(methyl)amino]-2-oxoethyl]-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]-2,2-dimethylpropanamide
ID: Reference10303
Other Names: NAT28-402609
Formula: C26H40N2O2
N-{[(1S,4S,6S)-4-{2-[Benzyl(methyl)amino]-2-oxoethyl}-6-isopropyl-3-methyl-2-cyclohexen-1-yl]methyl}-2,2-dimethylpropanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1370 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/16/2021 8:03:19 AM |
| InChI | InChI=1S/C26H40N2O2/c1-18(2)23-14-21(15-24(29)28(7)17-20-11-9-8-10-12-20)19(3)13-22(23)16-27-25(30)26(4,5)6/h8-13,18,21-23H,14-17H2,1-7H3,(H,27,30)/t21-,22-,23-/m0/s1 |
| InChI Key | VAUKYLRTSOUELR-VABKMULXSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)N(C)CC2=CC=CC=C2)C(C)C)CNC(=O)C(C)(C)C |
| CAS | |
| Splash | |
| Other Names | NAT28-402609 |