Systematic / IUPAC Name: N-[[(1S,4S,6S)-4-[2-[(4-Methoxyphenyl)methylamino]-2-oxoethyl]-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]cyclopentanecarboxamide
ID: Reference10304
Other Names: NAT28-404399
Formula: C27H40N2O3
N-{[(1S,4S,6S)-6-Isopropyl-4-{2-[(4-methoxybenzyl)amino]-2-oxoethyl}-3-methyl-2-cyclohexen-1-yl]methyl}cyclopentanecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1988 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/16/2021 8:09:16 AM |
| InChI | InChI=1S/C27H40N2O3/c1-18(2)25-14-22(15-26(30)28-16-20-9-11-24(32-4)12-10-20)19(3)13-23(25)17-29-27(31)21-7-5-6-8-21/h9-13,18,21-23,25H,5-8,14-17H2,1-4H3,(H,28,30)(H,29,31)/t22-,23-,25-/m0/s1 |
| InChI Key | QSUJIYAZJWDEJK-LSQMVHIFSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NCC2=CC=C(C=C2)OC)C(C)C)CNC(=O)C3CCCC3 |
| CAS | |
| Splash | |
| Other Names | NAT28-404399 |