Systematic / IUPAC Name: 2-Benzyl-5-[(3S)-1-propan-2-ylpyrrolidin-3-yl]-1,3,4-oxadiazole
ID: Reference10310
Other Names: NAT31-459431
Formula: C16H21N3O
2-Benzyl-5-[(3S)-1-isopropyl-3-pyrrolidinyl]-1,3,4-oxadiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1215 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/19/2021 1:57:30 PM |
| InChI | InChI=1S/C16H21N3O/c1-12(2)19-9-8-14(11-19)16-18-17-15(20-16)10-13-6-4-3-5-7-13/h3-7,12,14H,8-11H2,1-2H3/t14-/m0/s1 |
| InChI Key | IBVGSFOCMFNIEX-AWEZNQCLSA-N |
| Canonical SMILES | CC(C)N1CCC(C1)C2=NN=C(O2)CC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT31-459431 |