Systematic / IUPAC Name: 6-Fluoro-2-[(3S)-1-(1-methylpiperidin-4-yl)pyrrolidin-3-yl]-1H-benzimidazole
ID: Reference10313
Other Names: NAT31-457219
Formula: C17H23FN4
5-Fluoro-2-[(3S)-1-(1-methyl-4-piperidinyl)-3-pyrrolidinyl]-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1095 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/19/2021 2:09:06 PM |
| InChI | InChI=1S/C17H23FN4/c1-21-7-5-14(6-8-21)22-9-4-12(11-22)17-19-15-3-2-13(18)10-16(15)20-17/h2-3,10,12,14H,4-9,11H2,1H3,(H,19,20)/t12-/m0/s1 |
| InChI Key | BUUAUDYNFRAFIK-LBPRGKRZSA-N |
| Canonical SMILES | CN1CCC(CC1)N2CCC(C2)C3=NC4=C(N3)C=C(C=C4)F |
| CAS | |
| Splash | |
| Other Names | NAT31-457219 |