Systematic / IUPAC Name: N-[[(1S,4S,6S)-4-[2-[Benzyl(methyl)amino]-2-oxoethyl]-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]pyridine-3-carboxamide
ID: Reference10316
Other Names: NAT28-402579
Formula: C27H35N3O2
N-{[(1S,4S,6S)-4-{2-[Benzyl(methyl)amino]-2-oxoethyl}-6-isopropyl-3-methyl-2-cyclohexen-1-yl]methyl}nicotinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1472 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/26/2021 4:28:42 PM |
| InChI | InChI=1S/C27H35N3O2/c1-19(2)25-14-23(15-26(31)30(4)18-21-9-6-5-7-10-21)20(3)13-24(25)17-29-27(32)22-11-8-12-28-16-22/h5-13,16,19,23-25H,14-15,17-18H2,1-4H3,(H,29,32)/t23-,24-,25-/m0/s1 |
| InChI Key | OOIPNNYGQJMROU-SDHOMARFSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)N(C)CC2=CC=CC=C2)C(C)C)CNC(=O)C3=CN=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT28-402579 |