Systematic / IUPAC Name: 2-[(1S,4S,5S)-4-(Hydroxymethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-1-[4-(2-methoxyphenyl)piperazin-1-yl]ethanone
ID: Reference10317
Other Names:
Ethanone, 2-[(1S,4S,5S)-4-(hydroxymethyl)-2-methyl-5-(1-methylethyl)-2-cyclohexen-1-yl]-1-[4-(2-methoxyphenyl)-1-piperazinyl]-;
NAT28-410062
Formula: C24H36N2O3
2-[(1S,4S,5S)-4-(Hydroxymethyl)-5-isopropyl-2-methyl-2-cyclohexen-1-yl]-1-[4-(2-methoxyphenyl)-1-piperazinyl]ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1084 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/26/2021 4:31:35 PM |
| InChI | InChI=1S/C24H36N2O3/c1-17(2)21-14-19(18(3)13-20(21)16-27)15-24(28)26-11-9-25(10-12-26)22-7-5-6-8-23(22)29-4/h5-8,13,17,19-21,27H,9-12,14-16H2,1-4H3/t19-,20-,21-/m0/s1 |
| InChI Key | CDFMKBMDNQNXAC-ACRUOGEOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)N2CCN(CC2)C3=CC=CC=C3OC)C(C)C)CO |
| CAS | |
| Splash | |
| Other Names |
Ethanone, 2-[(1S,4S,5S)-4-(hydroxymethyl)-2-methyl-5-(1-methylethyl)-2-cyclohexen-1-yl]-1-[4-(2-methoxyphenyl)-1-piperazinyl]-; NAT28-410062 |