Systematic / IUPAC Name: 2-[(1S,4S,5S)-4-[(Ethylcarbamoylamino)methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-N-[(4-methoxyphenyl)methyl]acetamide
ID: Reference10318
Other Names: NAT28-404341
Formula: C24H37N3O3
2-[(1S,4S,5S)-4-{[(Ethylcarbamoyl)amino]methyl}-5-isopropyl-2-methyl-2-cyclohexen-1-yl]-N-(4-methoxybenzyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3777 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/26/2021 5:22:22 PM |
| InChI | InChI=1S/C24H37N3O3/c1-6-25-24(29)27-15-20-11-17(4)19(12-22(20)16(2)3)13-23(28)26-14-18-7-9-21(30-5)10-8-18/h7-11,16,19-20,22H,6,12-15H2,1-5H3,(H,26,28)(H2,25,27,29)/t19-,20-,22-/m0/s1 |
| InChI Key | SDLOJNDZNVSQBC-ONTIZHBOSA-N |
| Canonical SMILES | CCNC(=O)NCC1C=C(C(CC1C(C)C)CC(=O)NCC2=CC=C(C=C2)OC)C |
| CAS | |
| Splash | |
| Other Names | NAT28-404341 |