Systematic / IUPAC Name: 2-[(3S)-1-Cyclobutylpyrrolidin-3-yl]-6-methoxy-1H-benzimidazole
ID: Reference10322
Other Names: NAT31-457614
Formula: C16H21N3O
2-[(3S)-1-Cyclobutyl-3-pyrrolidinyl]-5-methoxy-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2127 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/26/2021 5:40:32 PM |
| InChI | InChI=1S/C16H21N3O/c1-20-13-5-6-14-15(9-13)18-16(17-14)11-7-8-19(10-11)12-3-2-4-12/h5-6,9,11-12H,2-4,7-8,10H2,1H3,(H,17,18)/t11-/m0/s1 |
| InChI Key | UAEBASDJOLJWLI-NSHDSACASA-N |
| Canonical SMILES | COC1=CC2=C(C=C1)N=C(N2)C3CCN(C3)C4CCC4 |
| CAS | |
| Splash | |
| Other Names | NAT31-457614 |