Systematic / IUPAC Name: 6-Methoxy-2-[(3S)-1-(pyridin-3-ylmethyl)pyrrolidin-3-yl]-1H-benzimidazole
ID: Reference10323
Other Names: NAT31-457637
Formula: C18H20N4O
5-Methoxy-2-[(3S)-1-(3-pyridinylmethyl)-3-pyrrolidinyl]-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2407 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/26/2021 5:52:57 PM |
| InChI | InChI=1S/C18H20N4O/c1-23-15-4-5-16-17(9-15)21-18(20-16)14-6-8-22(12-14)11-13-3-2-7-19-10-13/h2-5,7,9-10,14H,6,8,11-12H2,1H3,(H,20,21)/t14-/m0/s1 |
| InChI Key | BQYQQHSQVURSSJ-AWEZNQCLSA-N |
| Canonical SMILES | COC1=CC2=C(C=C1)N=C(N2)C3CCN(C3)CC4=CN=CC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT31-457637 |