Systematic / IUPAC Name: 2-[(3S)-1-(Cyclohexylmethyl)pyrrolidin-3-yl]-6-methoxy-1H-benzimidazole
ID: Reference10325
Other Names: NAT31-457615
Formula: C19H27N3O
2-[(3S)-1-(Cyclohexylmethyl)-3-pyrrolidinyl]-5-methoxy-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1513 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/31/2021 8:56:45 AM |
| InChI | InChI=1S/C19H27N3O/c1-23-16-7-8-17-18(11-16)21-19(20-17)15-9-10-22(13-15)12-14-5-3-2-4-6-14/h7-8,11,14-15H,2-6,9-10,12-13H2,1H3,(H,20,21)/t15-/m0/s1 |
| InChI Key | UBZBSXLGDJZDMT-HNNXBMFYSA-N |
| Canonical SMILES | COC1=CC2=C(C=C1)N=C(N2)C3CCN(C3)CC4CCCCC4 |
| CAS | |
| Splash | |
| Other Names | NAT31-457615 |