Systematic / IUPAC Name: 1-[4-[(3S)-3-(5-Phenyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone
ID: Reference10328
Other Names:
Ethanone, 1-[4-[(3S)-3-(5-phenyl-1,3,4-oxadiazol-2-yl)-1-pyrrolidinyl]-1-piperidinyl]-;
NAT31-458614
Formula: C19H24N4O2
1-{4-[(3S)-3-(5-Phenyl-1,3,4-oxadiazol-2-yl)-1-pyrrolidinyl]-1-piperidinyl}ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1696 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/31/2021 9:03:08 AM |
| InChI | InChI=1S/C19H24N4O2/c1-14(24)22-11-8-17(9-12-22)23-10-7-16(13-23)19-21-20-18(25-19)15-5-3-2-4-6-15/h2-6,16-17H,7-13H2,1H3/t16-/m0/s1 |
| InChI Key | QJHSISMUAUQKGE-INIZCTEOSA-N |
| Canonical SMILES | CC(=O)N1CCC(CC1)N2CCC(C2)C3=NN=C(O3)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names |
Ethanone, 1-[4-[(3S)-3-(5-phenyl-1,3,4-oxadiazol-2-yl)-1-pyrrolidinyl]-1-piperidinyl]-; NAT31-458614 |