Systematic / IUPAC Name: 2-[(3S)-1-Methylpyrrolidin-3-yl]-3H-benzimidazole-5-carbonitrile
ID: Reference10330
Other Names: NAT31-457739
Formula: C13H14N4
2-[(3S)-1-Methyl-3-pyrrolidinyl]-1H-benzimidazole-5-carbonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 159 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/31/2021 9:07:22 AM |
| InChI | InChI=1S/C13H14N4/c1-17-5-4-10(8-17)13-15-11-3-2-9(7-14)6-12(11)16-13/h2-3,6,10H,4-5,8H2,1H3,(H,15,16)/t10-/m0/s1 |
| InChI Key | KVASDMAGUYUERI-JTQLQIEISA-N |
| Canonical SMILES | CN1CCC(C1)C2=NC3=C(N2)C=C(C=C3)C#N |
| CAS | |
| Splash | |
| Other Names | NAT31-457739 |