Systematic / IUPAC Name: 2-[(3S)-1-[(3-Chlorophenyl)methyl]pyrrolidin-3-yl]-5-methyl-1,3-benzoxazole
ID: Reference10331
Other Names:
Benzoxazole, 2-[(3S)-1-[(3-chlorophenyl)methyl]-3-pyrrolidinyl]-5-methyl-;
NAT31-456725
Formula: C19H19ClN2O
2-[(3S)-1-(3-Chlorobenzyl)-3-pyrrolidinyl]-5-methyl-1,3-benzoxazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 855 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/26/2021 7:22:43 AM |
| InChI | InChI=1S/C19H19ClN2O/c1-13-5-6-18-17(9-13)21-19(23-18)15-7-8-22(12-15)11-14-3-2-4-16(20)10-14/h2-6,9-10,15H,7-8,11-12H2,1H3/t15-/m0/s1 |
| InChI Key | LHUUGKQLMUDCTQ-HNNXBMFYSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1)OC(=N2)C3CCN(C3)CC4=CC(=CC=C4)Cl |
| CAS | |
| Splash | |
| Other Names |
Benzoxazole, 2-[(3S)-1-[(3-chlorophenyl)methyl]-3-pyrrolidinyl]-5-methyl-; NAT31-456725 |