Systematic / IUPAC Name: 2-[(3S)-1-Cyclobutylpyrrolidin-3-yl]-6-fluoro-1H-benzimidazole
ID: Reference10336
Other Names: NAT31-457201
Formula: C15H18FN3
2-[(3S)-1-Cyclobutyl-3-pyrrolidinyl]-5-fluoro-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1360 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/26/2021 7:56:21 AM |
| InChI | InChI=1S/C15H18FN3/c16-11-4-5-13-14(8-11)18-15(17-13)10-6-7-19(9-10)12-2-1-3-12/h4-5,8,10,12H,1-3,6-7,9H2,(H,17,18)/t10-/m0/s1 |
| InChI Key | YVTGQHMXISXVDB-JTQLQIEISA-N |
| Canonical SMILES | C1CC(C1)N2CCC(C2)C3=NC4=C(N3)C=C(C=C4)F |
| CAS | |
| Splash | |
| Other Names | NAT31-457201 |