Systematic / IUPAC Name: N-[[(1S,4S,6S)-4-[2-[(4-Methoxyphenyl)methylamino]-2-oxoethyl]-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]furan-2-carboxamide
ID: Reference10341
Other Names: NAT28-404384
Formula: C26H34N2O4
N-{[(1S,4S,6S)-6-Isopropyl-4-{2-[(4-methoxybenzyl)amino]-2-oxoethyl}-3-methyl-2-cyclohexen-1-yl]methyl}-2-furamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 393 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/31/2021 9:21:29 AM |
| InChI | InChI=1S/C26H34N2O4/c1-17(2)23-13-20(14-25(29)27-15-19-7-9-22(31-4)10-8-19)18(3)12-21(23)16-28-26(30)24-6-5-11-32-24/h5-12,17,20-21,23H,13-16H2,1-4H3,(H,27,29)(H,28,30)/t20-,21-,23-/m0/s1 |
| InChI Key | HZRWGUCFRBNULU-FUDKSRODSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NCC2=CC=C(C=C2)OC)C(C)C)CNC(=O)C3=CC=CO3 |
| CAS | |
| Splash | |
| Other Names | NAT28-404384 |