Systematic / IUPAC Name: 2-[(3S)-1-Cyclobutylpyrrolidin-3-yl]-1H-imidazo[4,5-b]pyridine
ID: Reference10351
Other Names: NAT31-456611
Formula: C14H18N4
2-[(3S)-1-Cyclobutyl-3-pyrrolidinyl]-1H-imidazo[4,5-b]pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 849 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/1/2021 1:21:47 PM |
| InChI | InChI=1S/C14H18N4/c1-3-11(4-1)18-8-6-10(9-18)13-16-12-5-2-7-15-14(12)17-13/h2,5,7,10-11H,1,3-4,6,8-9H2,(H,15,16,17)/t10-/m0/s1 |
| InChI Key | XONIZWQHVCVEED-JTQLQIEISA-N |
| Canonical SMILES | C1CC(C1)N2CCC(C2)C3=NC4=C(N3)C=CC=N4 |
| CAS | |
| Splash | |
| Other Names | NAT31-456611 |