Systematic / IUPAC Name: 1-Methyl-2-[(3S)-1-[(2-methylphenyl)methyl]pyrrolidin-3-yl]benzimidazole
ID: Reference10367
Other Names: NAT31-470429
Formula: C20H23N3
1-Methyl-2-[(3S)-1-(2-methylbenzyl)-3-pyrrolidinyl]-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 780 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/9/2021 1:56:05 PM |
| InChI | InChI=1S/C20H23N3/c1-15-7-3-4-8-16(15)13-23-12-11-17(14-23)20-21-18-9-5-6-10-19(18)22(20)2/h3-10,17H,11-14H2,1-2H3/t17-/m0/s1 |
| InChI Key | UQGBRXRRCBJETP-KRWDZBQOSA-N |
| Canonical SMILES | CC1=CC=CC=C1CN2CCC(C2)C3=NC4=CC=CC=C4N3C |
| CAS | |
| Splash | |
| Other Names | NAT31-470429 |