Systematic / IUPAC Name: 2-[(1S,4S,5S)-4-(Cyanomethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-N-cyclohexylacetamide
ID: Reference10373
Other Names: NAT28-409873
Formula: C20H32N2O
2-[(1S,4S,5S)-4-(Cyanomethyl)-5-isopropyl-2-methyl-2-cyclohexen-1-yl]-N-cyclohexylacetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1015 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/16/2021 9:41:40 AM |
| InChI | InChI=1S/C20H32N2O/c1-14(2)19-12-17(15(3)11-16(19)9-10-21)13-20(23)22-18-7-5-4-6-8-18/h11,14,16-19H,4-9,12-13H2,1-3H3,(H,22,23)/t16-,17+,19+/m1/s1 |
| InChI Key | LDKCRZIITDVWFJ-AOIWGVFYSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NC2CCCCC2)C(C)C)CC#N |
| CAS | |
| Splash | |
| Other Names | NAT28-409873 |