Systematic / IUPAC Name: N-Benzyl-2-[(1S,4S,5S)-4-[(ethylcarbamoylamino)methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-N-methylacetamide
ID: Reference10374
Other Names: NAT28-402556
Formula: C24H37N3O2
N-Benzyl-2-[(1S,4S,5S)-4-{[(ethylcarbamoyl)amino]methyl}-5-isopropyl-2-methyl-2-cyclohexen-1-yl]-N-methylacetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1658 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/16/2021 9:49:02 AM |
| InChI | InChI=1S/C24H37N3O2/c1-6-25-24(29)26-15-21-12-18(4)20(13-22(21)17(2)3)14-23(28)27(5)16-19-10-8-7-9-11-19/h7-12,17,20-22H,6,13-16H2,1-5H3,(H2,25,26,29)/t20-,21-,22-/m0/s1 |
| InChI Key | XCXGMOJKOZDKBT-FKBYEOEOSA-N |
| Canonical SMILES | CCNC(=O)NCC1C=C(C(CC1C(C)C)CC(=O)N(C)CC2=CC=CC=C2)C |
| CAS | |
| Splash | |
| Other Names | NAT28-402556 |